About (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine
(5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine (PubChem CID 97178987) has the molecular formula C5H8BrN5
and a molecular weight of 218.06 g/mol. Its IUPAC name is (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine.
Molecular Properties
| Compound Name | (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine |
| PubChem CID | 97178987 |
| Molecular Formula | C5H8BrN5 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine |
| SMILES | C=CCn1nc(Br)nc1NN |
| InChI | InChI=1S/C5H8BrN5/c1-2-3-11-5(9-7)8-4(6)10-11/h2H,1,3,7H2,(H,8,9,10) |
| InChIKey | CBVLGBWGVDMVQL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine?
The IUPAC name of (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine (CID 97178987) is (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine.
What is the SMILES notation for (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine?
The canonical SMILES for (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine is C=CCn1nc(Br)nc1NN.
What is the InChIKey of (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine?
The InChIKey is CBVLGBWGVDMVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrN5/c1-2-3-11-5(9-7)8-4(6)10-11/h2H,1,3,7H2,(H,8,9,10).
What are the key properties of (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine?
(5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine has a molecular weight of 218.06 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-prop-2-enyl-1,2,4-triazol-3-yl)hydrazine is sourced from PubChem (CID 97178987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).