C11H10BrF3O2 — CID 97179841
(2S)-2-[[(1S)-1-(2-bromophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane (PubChem CID 97179841) has the molecular formula C11H10BrF3O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(2-bromophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane.
| Compound Name | (2S)-2-[[(1S)-1-(2-bromophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
|---|---|
| PubChem CID | 97179841 |
| Molecular Formula | C11H10BrF3O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (2S)-2-[[(1S)-1-(2-bromophenyl)-2,2,2-trifluoroethoxy]methyl]oxirane |
| SMILES | FC(F)(F)[C@@H](OC[C@@H]1CO1)c1ccccc1Br |
| InChI | InChI=1S/C11H10BrF3O2/c12-9-4-2-1-3-8(9)10(11(13,14)15)17-6-7-5-16-7/h1-4,7,10H,5-6H2/t7-,10-/m0/s1 |
| InChIKey | ZBYLJENHRNKREN-XVKPBYJWSA-N |
| XLogP | 3.47 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|