C10H7Cl2F3O3 — CID 97180306
2-[(1S)-1-(3,4-dichlorophenyl)-2,2,2-trifluoroethoxy]acetic acid (PubChem CID 97180306) has the molecular formula C10H7Cl2F3O3 and a molecular weight of 303.06 g/mol. Its IUPAC name is 2-[(1S)-1-(3,4-dichlorophenyl)-2,2,2-trifluoroethoxy]acetic acid.
| Compound Name | 2-[(1S)-1-(3,4-dichlorophenyl)-2,2,2-trifluoroethoxy]acetic acid |
|---|---|
| PubChem CID | 97180306 |
| Molecular Formula | C10H7Cl2F3O3 |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-[(1S)-1-(3,4-dichlorophenyl)-2,2,2-trifluoroethoxy]acetic acid |
| SMILES | O=C(O)CO[C@@H](c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H7Cl2F3O3/c11-6-2-1-5(3-7(6)12)9(10(13,14)15)18-4-8(16)17/h1-3,9H,4H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | SDHZUCHJDTVHGE-VIFPVBQESA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |