About 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine
3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine (PubChem CID 97180386) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine |
| PubChem CID | 97180386 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)ncn2C[C@@H]1CO1 |
| InChI | InChI=1S/C9H9N3O/c1-2-8-9(10-3-1)12(6-11-8)4-7-5-13-7/h1-3,6-7H,4-5H2/t7-/m1/s1 |
| InChIKey | YHNDGPMFHFQYJT-SSDOTTSWSA-N |
| XLogP | 0.83 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine?
The IUPAC name of 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine (CID 97180386) is 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine.
What is the SMILES notation for 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine?
The canonical SMILES for 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine is c1cnc2c(c1)ncn2C[C@@H]1CO1.
What is the InChIKey of 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine?
The InChIKey is YHNDGPMFHFQYJT-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H9N3O/c1-2-8-9(10-3-1)12(6-11-8)4-7-5-13-7/h1-3,6-7H,4-5H2/t7-/m1/s1.
What are the key properties of 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine?
3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine has a molecular weight of 175.19 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R)-oxiran-2-yl]methyl]imidazo[4,5-b]pyridine is sourced from PubChem (CID 97180386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).