About (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide
(2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide (PubChem CID 97181464) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide |
| PubChem CID | 97181464 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide |
| SMILES | Cc1cc(C)n([C@H](C)C(=O)N(C)C)c(=O)c1N |
| InChI | InChI=1S/C12H19N3O2/c1-7-6-8(2)15(12(17)10(7)13)9(3)11(16)14(4)5/h6,9H,13H2,1-5H3/t9-/m1/s1 |
| InChIKey | BBFFQFIAFUIJQV-SECBINFHSA-N |
| XLogP | 0.70 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide?
The IUPAC name of (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide (CID 97181464) is (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide.
What is the SMILES notation for (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide?
The canonical SMILES for (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide is Cc1cc(C)n([C@H](C)C(=O)N(C)C)c(=O)c1N.
What is the InChIKey of (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide?
The InChIKey is BBFFQFIAFUIJQV-SECBINFHSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-7-6-8(2)15(12(17)10(7)13)9(3)11(16)14(4)5/h6,9H,13H2,1-5H3/t9-/m1/s1.
What are the key properties of (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide?
(2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide has a molecular weight of 237.30 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3-amino-4,6-dimethyl-2-oxo-1-pyridinyl)-N,N-dimethylpropanamide is sourced from PubChem (CID 97181464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).