C14H17BrClNO3 — CID 97181684
methyl (2R)-2-[[[(2R)-2-bromopropanoyl]amino]methyl]-3-(4-chlorophenyl)propanoate (PubChem CID 97181684) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is methyl (2R)-2-[[[(2R)-2-bromopropanoyl]amino]methyl]-3-(4-chlorophenyl)propanoate.
| Compound Name | methyl (2R)-2-[[[(2R)-2-bromopropanoyl]amino]methyl]-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 97181684 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | methyl (2R)-2-[[[(2R)-2-bromopropanoyl]amino]methyl]-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)[C@@H](CNC(=O)[C@@H](C)Br)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17BrClNO3/c1-9(15)13(18)17-8-11(14(19)20-2)7-10-3-5-12(16)6-4-10/h3-6,9,11H,7-8H2,1-2H3,(H,17,18)/t9-,11-/m1/s1 |
| InChIKey | AVRVVAQZADXCHM-MWLCHTKSSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|