About (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine
(4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine (PubChem CID 97181754) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine.
Molecular Properties
| Compound Name | (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine |
| PubChem CID | 97181754 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine |
| SMILES | CC(C)n1ncc2c1CC[C@@H]2N |
| InChI | InChI=1S/C9H15N3/c1-6(2)12-9-4-3-8(10)7(9)5-11-12/h5-6,8H,3-4,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | XTUIXWMUUZJCDL-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine?
The IUPAC name of (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine (CID 97181754) is (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine.
What is the SMILES notation for (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine?
The canonical SMILES for (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine is CC(C)n1ncc2c1CC[C@@H]2N.
What is the InChIKey of (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine?
The InChIKey is XTUIXWMUUZJCDL-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15N3/c1-6(2)12-9-4-3-8(10)7(9)5-11-12/h5-6,8H,3-4,10H2,1-2H3/t8-/m0/s1.
What are the key properties of (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine?
(4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine has a molecular weight of 165.24 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine is sourced from PubChem (CID 97181754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).