About 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline
3-bromo-2,4-dichloro-6,8-dimethoxyquinoline (PubChem CID 97181901) has the molecular formula C11H8BrCl2NO2
and a molecular weight of 337.00 g/mol. Its IUPAC name is 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline.
Molecular Properties
| Compound Name | 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline |
| PubChem CID | 97181901 |
| Molecular Formula | C11H8BrCl2NO2 |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 334.91 |
| IUPAC Name | 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline |
| SMILES | COc1cc(OC)c2nc(Cl)c(Br)c(Cl)c2c1 |
| InChI | InChI=1S/C11H8BrCl2NO2/c1-16-5-3-6-9(13)8(12)11(14)15-10(6)7(4-5)17-2/h3-4H,1-2H3 |
| InChIKey | DSHCMAWBLLEISD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline?
The IUPAC name of 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline (CID 97181901) is 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline.
What is the SMILES notation for 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline?
The canonical SMILES for 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline is COc1cc(OC)c2nc(Cl)c(Br)c(Cl)c2c1.
What is the InChIKey of 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline?
The InChIKey is DSHCMAWBLLEISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrCl2NO2/c1-16-5-3-6-9(13)8(12)11(14)15-10(6)7(4-5)17-2/h3-4H,1-2H3.
What are the key properties of 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline?
3-bromo-2,4-dichloro-6,8-dimethoxyquinoline has a molecular weight of 337.00 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dichloro-6,8-dimethoxyquinoline is sourced from PubChem (CID 97181901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).