C12H12ClNO2 — CID 97182063
(3S)-1-[(4-chlorophenyl)methyl]-5-oxopyrrolidine-3-carbaldehyde (PubChem CID 97182063) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (3S)-1-[(4-chlorophenyl)methyl]-5-oxopyrrolidine-3-carbaldehyde.
| Compound Name | (3S)-1-[(4-chlorophenyl)methyl]-5-oxopyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 97182063 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (3S)-1-[(4-chlorophenyl)methyl]-5-oxopyrrolidine-3-carbaldehyde |
| SMILES | O=C[C@H]1CC(=O)N(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H12ClNO2/c13-11-3-1-9(2-4-11)6-14-7-10(8-15)5-12(14)16/h1-4,8,10H,5-7H2/t10-/m0/s1 |
| InChIKey | HQNJEKGVITWHDD-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|