About (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide
(2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide (PubChem CID 971822) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide.
Molecular Properties
| Compound Name | (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide |
| PubChem CID | 971822 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)NC2CCCCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H24N2OS/c1-10-8-15(9-11(2)16-10)13(17)14-12-6-4-3-5-7-12/h10-12H,3-9H2,1-2H3,(H,14,17)/t10-,11+ |
| InChIKey | VLWINADMPFZZEA-PHIMTYICSA-N |
| XLogP | 2.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide?
The IUPAC name of (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide (CID 971822) is (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide.
What is the SMILES notation for (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide?
The canonical SMILES for (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide is C[C@@H]1CN(C(=S)NC2CCCCC2)C[C@H](C)O1.
What is the InChIKey of (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide?
The InChIKey is VLWINADMPFZZEA-PHIMTYICSA-N. The full InChI is InChI=1S/C13H24N2OS/c1-10-8-15(9-11(2)16-10)13(17)14-12-6-4-3-5-7-12/h10-12H,3-9H2,1-2H3,(H,14,17)/t10-,11+.
What are the key properties of (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide?
(2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide has a molecular weight of 256.41 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-N-cyclohexyl-2,6-dimethylmorpholine-4-carbothioamide is sourced from PubChem (CID 971822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).