C36H33BrN2O4 — CID 97182439
(2R,6S,8R,12S)-1-(4-bromophenyl)-4,10-bis(2,4,6-trimethylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 97182439) has the molecular formula C36H33BrN2O4 and a molecular weight of 637.57 g/mol. Its IUPAC name is (2R,6S,8R,12S)-1-(4-bromophenyl)-4,10-bis(2,4,6-trimethylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2R,6S,8R,12S)-1-(4-bromophenyl)-4,10-bis(2,4,6-trimethylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 97182439 |
| Molecular Formula | C36H33BrN2O4 |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | (2R,6S,8R,12S)-1-(4-bromophenyl)-4,10-bis(2,4,6-trimethylphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | Cc1cc(C)c(N2C(=O)[C@@H]3[C@@H](C2=O)C2C=CC3(c3ccc(Br)cc3)[C@H]3C(=O)N(c4c(C)cc(C)cc4C)C(=O)[C@H]23)c(C)c1 |
| InChI | InChI=1S/C36H33BrN2O4/c1-17-13-19(3)30(20(4)14-17)38-32(40)26-25-11-12-36(28(26)34(38)42,23-7-9-24(37)10-8-23)29-27(25)33(41)39(35(29)43)31-21(5)15-18(2)16-22(31)6/h7-16,25-29H,1-6H3/t25?,26-,27+,28-,29+,36? |
| InChIKey | FEUMPYUVRCXGOP-NMONXFGTSA-N |
| XLogP | 6.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|