C20H15FN2O2S — CID 97182545
(1S,9S,13Z)-13-[(4-fluorophenyl)methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one (PubChem CID 97182545) has the molecular formula C20H15FN2O2S and a molecular weight of 366.42 g/mol. Its IUPAC name is (1S,9S,13Z)-13-[(4-fluorophenyl)methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one.
| Compound Name | (1S,9S,13Z)-13-[(4-fluorophenyl)methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
|---|---|
| PubChem CID | 97182545 |
| Molecular Formula | C20H15FN2O2S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (1S,9S,13Z)-13-[(4-fluorophenyl)methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
| SMILES | C[C@@]12C[C@@H](c3ccccc3O1)n1c(s/c(=C\c3ccc(F)cc3)c1=O)=N2 |
| InChI | InChI=1S/C20H15FN2O2S/c1-20-11-15(14-4-2-3-5-16(14)25-20)23-18(24)17(26-19(23)22-20)10-12-6-8-13(21)9-7-12/h2-10,15H,11H2,1H3/b17-10-/t15-,20-/m0/s1 |
| InChIKey | OHYHHPKSANIMAK-JMWOSGIGSA-N |
| XLogP | 2.60 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |