C9H11N3O2S — CID 97183618
(3S,5R)-5-cyano-4,4-dimethyl-2,6-dioxopiperidine-3-carbothioamide (PubChem CID 97183618) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is (3S,5R)-5-cyano-4,4-dimethyl-2,6-dioxopiperidine-3-carbothioamide.
| Compound Name | (3S,5R)-5-cyano-4,4-dimethyl-2,6-dioxopiperidine-3-carbothioamide |
|---|---|
| PubChem CID | 97183618 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (3S,5R)-5-cyano-4,4-dimethyl-2,6-dioxopiperidine-3-carbothioamide |
| SMILES | CC1(C)[C@H](C(N)=S)C(=O)NC(=O)[C@H]1C#N |
| InChI | InChI=1S/C9H11N3O2S/c1-9(2)4(3-10)7(13)12-8(14)5(9)6(11)15/h4-5H,1-2H3,(H2,11,15)(H,12,13,14)/t4-,5-/m1/s1 |
| InChIKey | VPSUDLOPPTWEMZ-RFZPGFLSSA-N |
| XLogP | -0.29 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|