C23H20N4 — CID 97183640
2-[(6R)-4-cyano-6-methyl-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl]-2-prop-2-enylpropanedinitrile (PubChem CID 97183640) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[(6R)-4-cyano-6-methyl-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl]-2-prop-2-enylpropanedinitrile.
| Compound Name | 2-[(6R)-4-cyano-6-methyl-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl]-2-prop-2-enylpropanedinitrile |
|---|---|
| PubChem CID | 97183640 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[(6R)-4-cyano-6-methyl-1-phenyl-5,6,7,8-tetrahydroisoquinolin-3-yl]-2-prop-2-enylpropanedinitrile |
| SMILES | C=CCC(C#N)(C#N)c1nc(-c2ccccc2)c2c(c1C#N)C[C@H](C)CC2 |
| InChI | InChI=1S/C23H20N4/c1-3-11-23(14-25,15-26)22-20(13-24)19-12-16(2)9-10-18(19)21(27-22)17-7-5-4-6-8-17/h3-8,16H,1,9-12H2,2H3/t16-/m1/s1 |
| InChIKey | JTCGYSYBYGEVPR-MRXNPFEDSA-N |
| XLogP | 4.61 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|