About 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine
2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine (PubChem CID 97184453) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine.
Molecular Properties
| Compound Name | 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine |
| PubChem CID | 97184453 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine |
| SMILES | NC(N)=NC[C@H]1COC2(CCCCCC2)O1 |
| InChI | InChI=1S/C11H21N3O2/c12-10(13)14-7-9-8-15-11(16-9)5-3-1-2-4-6-11/h9H,1-8H2,(H4,12,13,14)/t9-/m0/s1 |
| InChIKey | LLTTXPQVCIGSAJ-VIFPVBQESA-N |
| XLogP | 0.73 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine?
The IUPAC name of 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine (CID 97184453) is 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine.
What is the SMILES notation for 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine?
The canonical SMILES for 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine is NC(N)=NC[C@H]1COC2(CCCCCC2)O1.
What is the InChIKey of 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine?
The InChIKey is LLTTXPQVCIGSAJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H21N3O2/c12-10(13)14-7-9-8-15-11(16-9)5-3-1-2-4-6-11/h9H,1-8H2,(H4,12,13,14)/t9-/m0/s1.
What are the key properties of 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine?
2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine has a molecular weight of 227.31 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S)-1,4-dioxaspiro[4.6]undecan-3-yl]methyl]guanidine is sourced from PubChem (CID 97184453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).