About (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine
(1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine (PubChem CID 97184516) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine |
| PubChem CID | 97184516 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine |
| SMILES | C[C@H](N)C1=CCN(C)CC1 |
| InChI | InChI=1S/C8H16N2/c1-7(9)8-3-5-10(2)6-4-8/h3,7H,4-6,9H2,1-2H3/t7-/m0/s1 |
| InChIKey | FGXZEDMDGLAUPT-ZETCQYMHSA-N |
| XLogP | 0.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine?
The IUPAC name of (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine (CID 97184516) is (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine.
What is the SMILES notation for (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine?
The canonical SMILES for (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine is C[C@H](N)C1=CCN(C)CC1.
What is the InChIKey of (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine?
The InChIKey is FGXZEDMDGLAUPT-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(9)8-3-5-10(2)6-4-8/h3,7H,4-6,9H2,1-2H3/t7-/m0/s1.
What are the key properties of (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine?
(1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine has a molecular weight of 140.23 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine is sourced from PubChem (CID 97184516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).