C12H19N3O2 — CID 97184680
tert-butyl N-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]carbamate (PubChem CID 97184680) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]carbamate.
| Compound Name | tert-butyl N-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]carbamate |
|---|---|
| PubChem CID | 97184680 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | tert-butyl N-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)17-11(16)14-9-6-4-5-8-7-13-15-10(8)9/h7,9H,4-6H2,1-3H3,(H,13,15)(H,14,16)/t9-/m0/s1 |
| InChIKey | UNPDFDSZXIRIEB-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |