C17H21N3O — CID 97185080
trans-(1R,3S)-N-(1H-indazol-3-yl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 97185080) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is trans-(1R,3S)-N-(1H-indazol-3-yl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3S)-N-(1H-indazol-3-yl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97185080 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | trans-(1R,3S)-N-(1H-indazol-3-yl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)=C[C@H]1[C@@H](C(=O)Nc2n[nH]c3ccccc23)C1(C)C |
| InChI | InChI=1S/C17H21N3O/c1-10(2)9-12-14(17(12,3)4)16(21)18-15-11-7-5-6-8-13(11)19-20-15/h5-9,12,14H,1-4H3,(H2,18,19,20,21)/t12-,14-/m0/s1 |
| InChIKey | ADYCBWQYAUTSLL-JSGCOSHPSA-N |
| XLogP | 3.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|