C13H17N3O2S — CID 97185358
(8aS)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 97185358) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is (8aS)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | (8aS)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 97185358 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (8aS)-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | CCc1nc(CN2C(=O)[C@@H]3CCCCN3C2=O)cs1 |
| InChI | InChI=1S/C13H17N3O2S/c1-2-11-14-9(8-19-11)7-16-12(17)10-5-3-4-6-15(10)13(16)18/h8,10H,2-7H2,1H3/t10-/m0/s1 |
| InChIKey | LOVKZMDSPNZFFZ-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|