About [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate
[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate (PubChem CID 97185726) has the molecular formula C14H16BrNO3
and a molecular weight of 326.19 g/mol. Its IUPAC name is [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate.
Molecular Properties
| Compound Name | [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate |
| PubChem CID | 97185726 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)O[C@@H]1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H16BrNO3/c1-9(17)16-7-6-14(18)19-13-5-2-10-8-11(15)3-4-12(10)13/h3-4,8,13H,2,5-7H2,1H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | YMDNRKZVGRDUBM-CYBMUJFWSA-N |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate?
The IUPAC name of [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate (CID 97185726) is [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate.
What is the SMILES notation for [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate?
The canonical SMILES for [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate is CC(=O)NCCC(=O)O[C@@H]1CCc2cc(Br)ccc21.
What is the InChIKey of [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate?
The InChIKey is YMDNRKZVGRDUBM-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H16BrNO3/c1-9(17)16-7-6-14(18)19-13-5-2-10-8-11(15)3-4-12(10)13/h3-4,8,13H,2,5-7H2,1H3,(H,16,17)/t13-/m1/s1.
What are the key properties of [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate?
[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate has a molecular weight of 326.19 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl] 3-acetamidopropanoate is sourced from PubChem (CID 97185726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).