C14H19F3N4O2S — CID 97186656
(E,2S)-2-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]hept-3-enoic acid (PubChem CID 97186656) has the molecular formula C14H19F3N4O2S and a molecular weight of 364.39 g/mol. Its IUPAC name is (E,2S)-2-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]hept-3-enoic acid.
| Compound Name | (E,2S)-2-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]hept-3-enoic acid |
|---|---|
| PubChem CID | 97186656 |
| Molecular Formula | C14H19F3N4O2S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (E,2S)-2-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazin-1-yl]hept-3-enoic acid |
| SMILES | CCC/C=C/[C@@H](C(=O)O)N1CCN(c2nnc(C(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C14H19F3N4O2S/c1-2-3-4-5-10(11(22)23)20-6-8-21(9-7-20)13-19-18-12(24-13)14(15,16)17/h4-5,10H,2-3,6-9H2,1H3,(H,22,23)/b5-4+/t10-/m0/s1 |
| InChIKey | OUFIWUTXPXWYMT-YEZKRMTDSA-N |
| XLogP | 2.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|