C20H21FN4O — CID 97186840
(2R)-2-(dimethylamino)-2-(2-fluorophenyl)-N-[(2-imidazol-1-ylphenyl)methyl]acetamide (PubChem CID 97186840) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-2-(2-fluorophenyl)-N-[(2-imidazol-1-ylphenyl)methyl]acetamide.
| Compound Name | (2R)-2-(dimethylamino)-2-(2-fluorophenyl)-N-[(2-imidazol-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 97186840 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2R)-2-(dimethylamino)-2-(2-fluorophenyl)-N-[(2-imidazol-1-ylphenyl)methyl]acetamide |
| SMILES | CN(C)[C@@H](C(=O)NCc1ccccc1-n1ccnc1)c1ccccc1F |
| InChI | InChI=1S/C20H21FN4O/c1-24(2)19(16-8-4-5-9-17(16)21)20(26)23-13-15-7-3-6-10-18(15)25-12-11-22-14-25/h3-12,14,19H,13H2,1-2H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | AHOORDZJDZYARN-LJQANCHMSA-N |
| XLogP | 2.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |