C22H23F2N3 — CID 97187048
(2R)-N-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 97187048) has the molecular formula C22H23F2N3 and a molecular weight of 367.44 g/mol. Its IUPAC name is (2R)-N-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-N-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 97187048 |
| Molecular Formula | C22H23F2N3 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2R)-N-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | Cc1nn(-c2ccc(F)cc2F)c(C)c1CN[C@@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H23F2N3/c1-14-20(13-25-19-9-7-16-5-3-4-6-17(16)11-19)15(2)27(26-14)22-10-8-18(23)12-21(22)24/h3-6,8,10,12,19,25H,7,9,11,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | NSKIPSYYMKTCCX-LJQANCHMSA-N |
| XLogP | 4.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |