About (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol
(S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol (PubChem CID 97187333) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol.
Molecular Properties
| Compound Name | (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol |
| PubChem CID | 97187333 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol |
| SMILES | Cc1noc2ncnc(N3CCC([C@H](O)c4cccs4)CC3)c12 |
| InChI | InChI=1S/C16H18N4O2S/c1-10-13-15(17-9-18-16(13)22-19-10)20-6-4-11(5-7-20)14(21)12-3-2-8-23-12/h2-3,8-9,11,14,21H,4-7H2,1H3/t14-/m0/s1 |
| InChIKey | VCGDAFPWDMTNQS-AWEZNQCLSA-N |
| XLogP | 2.94 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol?
The IUPAC name of (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol (CID 97187333) is (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol.
What is the SMILES notation for (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol?
The canonical SMILES for (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol is Cc1noc2ncnc(N3CCC([C@H](O)c4cccs4)CC3)c12.
What is the InChIKey of (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol?
The InChIKey is VCGDAFPWDMTNQS-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H18N4O2S/c1-10-13-15(17-9-18-16(13)22-19-10)20-6-4-11(5-7-20)14(21)12-3-2-8-23-12/h2-3,8-9,11,14,21H,4-7H2,1H3/t14-/m0/s1.
What are the key properties of (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol?
(S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol has a molecular weight of 330.41 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-[1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]-thiophen-2-ylmethanol is sourced from PubChem (CID 97187333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).