C12H13N5O2S — CID 97189194
2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-5-nitropyrimidin-4-amine (PubChem CID 97189194) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 97189194 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-5-nitropyrimidin-4-amine |
| SMILES | C[C@@H]1c2ccsc2CCN1c1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C12H13N5O2S/c1-7-8-3-5-20-10(8)2-4-16(7)12-14-6-9(17(18)19)11(13)15-12/h3,5-7H,2,4H2,1H3,(H2,13,14,15)/t7-/m1/s1 |
| InChIKey | MXQRPRYYRFMPOE-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|