C18H20N6O2 — CID 97189519
(7S)-7-(2-methoxyphenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydro-1H-imidazo[4,5-c]azepin-4-one (PubChem CID 97189519) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (7S)-7-(2-methoxyphenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydro-1H-imidazo[4,5-c]azepin-4-one.
| Compound Name | (7S)-7-(2-methoxyphenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydro-1H-imidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 97189519 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (7S)-7-(2-methoxyphenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydro-1H-imidazo[4,5-c]azepin-4-one |
| SMILES | COc1ccccc1[C@H]1CNC(=O)c2nc(Cc3ncnn3C)[nH]c2C1 |
| InChI | InChI=1S/C18H20N6O2/c1-24-16(20-10-21-24)8-15-22-13-7-11(9-19-18(25)17(13)23-15)12-5-3-4-6-14(12)26-2/h3-6,10-11H,7-9H2,1-2H3,(H,19,25)(H,22,23)/t11-/m1/s1 |
| InChIKey | JELVUOJCTNIELJ-LLVKDONJSA-N |
| XLogP | 1.21 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |