C18H28N4O3S — CID 97189914
(5S)-2-(2-amino-4-ethyl-1,3-thiazole-5-carbonyl)-7-(3-methoxypropyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97189914) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (5S)-2-(2-amino-4-ethyl-1,3-thiazole-5-carbonyl)-7-(3-methoxypropyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-2-(2-amino-4-ethyl-1,3-thiazole-5-carbonyl)-7-(3-methoxypropyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97189914 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (5S)-2-(2-amino-4-ethyl-1,3-thiazole-5-carbonyl)-7-(3-methoxypropyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | CCc1nc(N)sc1C(=O)N1CC[C@@]2(CCCN(CCCOC)C2=O)C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-3-13-14(26-17(19)20-13)15(23)22-10-7-18(12-22)6-4-8-21(16(18)24)9-5-11-25-2/h3-12H2,1-2H3,(H2,19,20)/t18-/m0/s1 |
| InChIKey | WELZOZZECXDMNB-SFHVURJKSA-N |
| XLogP | 1.78 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|