C23H24N2O3 — CID 97190753
3-[(3R)-1-(1,7-dimethylindole-2-carbonyl)piperidin-3-yl]benzoic acid (PubChem CID 97190753) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[(3R)-1-(1,7-dimethylindole-2-carbonyl)piperidin-3-yl]benzoic acid.
| Compound Name | 3-[(3R)-1-(1,7-dimethylindole-2-carbonyl)piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97190753 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[(3R)-1-(1,7-dimethylindole-2-carbonyl)piperidin-3-yl]benzoic acid |
| SMILES | Cc1cccc2cc(C(=O)N3CCC[C@H](c4cccc(C(=O)O)c4)C3)n(C)c12 |
| InChI | InChI=1S/C23H24N2O3/c1-15-6-3-8-17-13-20(24(2)21(15)17)22(26)25-11-5-10-19(14-25)16-7-4-9-18(12-16)23(27)28/h3-4,6-9,12-13,19H,5,10-11,14H2,1-2H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | GSPUEGCEVAJZEC-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |