C21H24N2O5 — CID 97191045
(2R)-2-(2-methoxyphenyl)-2-[4-[(3-methoxyphenyl)methyl]-3-oxopiperazin-1-yl]acetic acid (PubChem CID 97191045) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (2R)-2-(2-methoxyphenyl)-2-[4-[(3-methoxyphenyl)methyl]-3-oxopiperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(2-methoxyphenyl)-2-[4-[(3-methoxyphenyl)methyl]-3-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97191045 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (2R)-2-(2-methoxyphenyl)-2-[4-[(3-methoxyphenyl)methyl]-3-oxopiperazin-1-yl]acetic acid |
| SMILES | COc1cccc(CN2CCN([C@@H](C(=O)O)c3ccccc3OC)CC2=O)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-27-16-7-5-6-15(12-16)13-22-10-11-23(14-19(22)24)20(21(25)26)17-8-3-4-9-18(17)28-2/h3-9,12,20H,10-11,13-14H2,1-2H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | WZUBFWPVUPPCBI-HXUWFJFHSA-N |
| XLogP | 2.17 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |