C17H21N3O4S — CID 97191248
4-[(3S)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-3-yl]benzoic acid (PubChem CID 97191248) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[(3S)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-3-yl]benzoic acid.
| Compound Name | 4-[(3S)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97191248 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-[(3S)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-3-yl]benzoic acid |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCC[C@@H](c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C17H21N3O4S/c1-12-16(11-19(2)18-12)25(23,24)20-9-3-4-15(10-20)13-5-7-14(8-6-13)17(21)22/h5-8,11,15H,3-4,9-10H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | BGBCSWVKHQSSKE-OAHLLOKOSA-N |
| XLogP | 2.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |