C17H26N2O4 — CID 97191729
(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyethyl)-N,4-dimethylpentanamide (PubChem CID 97191729) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyethyl)-N,4-dimethylpentanamide.
| Compound Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyethyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 97191729 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2-hydroxyethyl)-N,4-dimethylpentanamide |
| SMILES | CC(C)C[C@H](C(=O)N(C)CCO)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C17H26N2O4/c1-11(2)10-14(17(23)18(3)8-9-20)19-15(21)12-6-4-5-7-13(12)16(19)22/h4-5,11-14,20H,6-10H2,1-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | WLMIRBFKDZDSED-HZSPNIEDSA-N |
| XLogP | 0.80 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|