C23H25N3O2 — CID 97193156
(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-quinolin-8-yloxyethyl)propanamide (PubChem CID 97193156) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-quinolin-8-yloxyethyl)propanamide.
| Compound Name | (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-quinolin-8-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 97193156 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-quinolin-8-yloxyethyl)propanamide |
| SMILES | C[C@H](C(=O)NCCOc1cccc2cccnc12)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H25N3O2/c1-17(26-14-11-18-6-2-3-7-20(18)16-26)23(27)25-13-15-28-21-10-4-8-19-9-5-12-24-22(19)21/h2-10,12,17H,11,13-16H2,1H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | DVCOGEUCNVLJTC-QGZVFWFLSA-N |
| XLogP | 3.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|