C19H22N2O3S — CID 97193811
(2R)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-2-(4-methylsulfanylphenyl)acetic acid (PubChem CID 97193811) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-2-(4-methylsulfanylphenyl)acetic acid.
| Compound Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-2-(4-methylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 97193811 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-2-(4-methylsulfanylphenyl)acetic acid |
| SMILES | CSc1ccc([C@H](C(=O)O)N2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-25-15-8-6-14(7-9-15)18(19(23)24)21-12-10-20(11-13-21)16-4-2-3-5-17(16)22/h2-9,18,22H,10-13H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | GVWWXEWBCNXSRW-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |