C24H28N2O2 — CID 97194947
(4S)-2-methyl-9-(3-methylbenzoyl)-4-phenyl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 97194947) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (4S)-2-methyl-9-(3-methylbenzoyl)-4-phenyl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | (4S)-2-methyl-9-(3-methylbenzoyl)-4-phenyl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97194947 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (4S)-2-methyl-9-(3-methylbenzoyl)-4-phenyl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | Cc1cccc(C(=O)N2CCC3(CC2)C[C@@H](c2ccccc2)C(=O)N(C)C3)c1 |
| InChI | InChI=1S/C24H28N2O2/c1-18-7-6-10-20(15-18)22(27)26-13-11-24(12-14-26)16-21(23(28)25(2)17-24)19-8-4-3-5-9-19/h3-10,15,21H,11-14,16-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | IYEHXEHWTSMVDK-NRFANRHFSA-N |
| XLogP | 3.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |