C17H24N2O4 — CID 97195949
2-[(3S)-3-hydroxypiperidin-1-yl]-1-[3-(2-methoxyphenoxy)azetidin-1-yl]ethanone (PubChem CID 97195949) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[3-(2-methoxyphenoxy)azetidin-1-yl]ethanone.
| Compound Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[3-(2-methoxyphenoxy)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97195949 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[3-(2-methoxyphenoxy)azetidin-1-yl]ethanone |
| SMILES | COc1ccccc1OC1CN(C(=O)CN2CCC[C@H](O)C2)C1 |
| InChI | InChI=1S/C17H24N2O4/c1-22-15-6-2-3-7-16(15)23-14-10-19(11-14)17(21)12-18-8-4-5-13(20)9-18/h2-3,6-7,13-14,20H,4-5,8-12H2,1H3/t13-/m0/s1 |
| InChIKey | CPEMSCSACFSPNX-ZDUSSCGKSA-N |
| XLogP | 0.74 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |