About (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine
(2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine (PubChem CID 97196275) has the molecular formula C14H23N7O3
and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine.
Molecular Properties
| Compound Name | (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine |
| PubChem CID | 97196275 |
| Molecular Formula | C14H23N7O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine |
| SMILES | COCCn1nnc([C@@H]2CN(c3nnc(C(C)(C)C)o3)CCO2)n1 |
| InChI | InChI=1S/C14H23N7O3/c1-14(2,3)12-16-17-13(24-12)20-5-8-23-10(9-20)11-15-19-21(18-11)6-7-22-4/h10H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | ZMHOGVCRSKWTPX-JTQLQIEISA-N |
| XLogP | 0.58 |
| TPSA | 104.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine?
The IUPAC name of (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine (CID 97196275) is (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine.
What is the SMILES notation for (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine?
The canonical SMILES for (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine is COCCn1nnc([C@@H]2CN(c3nnc(C(C)(C)C)o3)CCO2)n1.
What is the InChIKey of (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine?
The InChIKey is ZMHOGVCRSKWTPX-JTQLQIEISA-N. The full InChI is InChI=1S/C14H23N7O3/c1-14(2,3)12-16-17-13(24-12)20-5-8-23-10(9-20)11-15-19-21(18-11)6-7-22-4/h10H,5-9H2,1-4H3/t10-/m0/s1.
What are the key properties of (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine?
(2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine has a molecular weight of 337.38 g/mol, XLogP of 0.58, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine is sourced from PubChem (CID 97196275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).