C20H23FN2O3 — CID 97198398
(2R)-2-(dimethylamino)-2-(4-fluorophenyl)-1-[3-(3-methoxyphenoxy)azetidin-1-yl]ethanone (PubChem CID 97198398) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-1-[3-(3-methoxyphenoxy)azetidin-1-yl]ethanone.
| Compound Name | (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-1-[3-(3-methoxyphenoxy)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97198398 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2R)-2-(dimethylamino)-2-(4-fluorophenyl)-1-[3-(3-methoxyphenoxy)azetidin-1-yl]ethanone |
| SMILES | COc1cccc(OC2CN(C(=O)[C@@H](c3ccc(F)cc3)N(C)C)C2)c1 |
| InChI | InChI=1S/C20H23FN2O3/c1-22(2)19(14-7-9-15(21)10-8-14)20(24)23-12-18(13-23)26-17-6-4-5-16(11-17)25-3/h4-11,18-19H,12-13H2,1-3H3/t19-/m1/s1 |
| InChIKey | SJJJHOLLJYMEGG-LJQANCHMSA-N |
| XLogP | 2.73 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |