About (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol
(5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol (PubChem CID 97199554) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol.
Molecular Properties
| Compound Name | (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| PubChem CID | 97199554 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| SMILES | COc1cc(OC)nc(N2CCC3(CC2)OCCC[C@H]3O)n1 |
| InChI | InChI=1S/C15H23N3O4/c1-20-12-10-13(21-2)17-14(16-12)18-7-5-15(6-8-18)11(19)4-3-9-22-15/h10-11,19H,3-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | UTZJIZASQZJLHN-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The IUPAC name of (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol (CID 97199554) is (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol.
What is the SMILES notation for (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The canonical SMILES for (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol is COc1cc(OC)nc(N2CCC3(CC2)OCCC[C@H]3O)n1.
What is the InChIKey of (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The InChIKey is UTZJIZASQZJLHN-LLVKDONJSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-20-12-10-13(21-2)17-14(16-12)18-7-5-15(6-8-18)11(19)4-3-9-22-15/h10-11,19H,3-9H2,1-2H3/t11-/m1/s1.
What are the key properties of (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol?
(5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol has a molecular weight of 309.37 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-9-(4,6-dimethoxypyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol is sourced from PubChem (CID 97199554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).