C17H25N3O2 — CID 97199968
(E,2S)-5,5-dimethyl-2-(4-pyridin-4-ylpiperazin-1-yl)hex-3-enoic acid (PubChem CID 97199968) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (E,2S)-5,5-dimethyl-2-(4-pyridin-4-ylpiperazin-1-yl)hex-3-enoic acid.
| Compound Name | (E,2S)-5,5-dimethyl-2-(4-pyridin-4-ylpiperazin-1-yl)hex-3-enoic acid |
|---|---|
| PubChem CID | 97199968 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (E,2S)-5,5-dimethyl-2-(4-pyridin-4-ylpiperazin-1-yl)hex-3-enoic acid |
| SMILES | CC(C)(C)/C=C/[C@@H](C(=O)O)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-17(2,3)7-4-15(16(21)22)20-12-10-19(11-13-20)14-5-8-18-9-6-14/h4-9,15H,10-13H2,1-3H3,(H,21,22)/b7-4+/t15-/m0/s1 |
| InChIKey | OGALTEPNCHVVDX-SZTZYQKNSA-N |
| XLogP | 2.26 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|