C22H27NO4 — CID 97200432
3-[(3S)-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-3-yl]benzoic acid (PubChem CID 97200432) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[(3S)-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-3-yl]benzoic acid.
| Compound Name | 3-[(3S)-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97200432 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3-[(3S)-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-3-yl]benzoic acid |
| SMILES | COCc1cc(CN2CCC[C@@H](c3cccc(C(=O)O)c3)C2)ccc1OC |
| InChI | InChI=1S/C22H27NO4/c1-26-15-20-11-16(8-9-21(20)27-2)13-23-10-4-7-19(14-23)17-5-3-6-18(12-17)22(24)25/h3,5-6,8-9,11-12,19H,4,7,10,13-15H2,1-2H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | IUKUUSVIHBEYOQ-LJQANCHMSA-N |
| XLogP | 3.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |