C19H28ClN5O2 — CID 97201196
(3S)-3-[4-[(6-chloro-3-pyridinyl)methyl]piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 97201196) has the molecular formula C19H28ClN5O2 and a molecular weight of 393.92 g/mol. Its IUPAC name is (3S)-3-[4-[(6-chloro-3-pyridinyl)methyl]piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[4-[(6-chloro-3-pyridinyl)methyl]piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 97201196 |
| Molecular Formula | C19H28ClN5O2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (3S)-3-[4-[(6-chloro-3-pyridinyl)methyl]piperazine-1-carbonyl]-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC[C@H](C(=O)N2CCN(Cc3ccc(Cl)nc3)CC2)C1 |
| InChI | InChI=1S/C19H28ClN5O2/c1-22(2)19(27)25-7-3-4-16(14-25)18(26)24-10-8-23(9-11-24)13-15-5-6-17(20)21-12-15/h5-6,12,16H,3-4,7-11,13-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | CINBUEBTIWECCN-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 59.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|