C16H22N6O2 — CID 97201492
(9aS)-2-(2-amino-6-methyl-5-prop-2-enylpyrimidin-4-yl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 97201492) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (9aS)-2-(2-amino-6-methyl-5-prop-2-enylpyrimidin-4-yl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aS)-2-(2-amino-6-methyl-5-prop-2-enylpyrimidin-4-yl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 97201492 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (9aS)-2-(2-amino-6-methyl-5-prop-2-enylpyrimidin-4-yl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C=CCc1c(C)nc(N)nc1N1CCN2C(=O)CN(C)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H22N6O2/c1-4-5-11-10(2)18-16(17)19-14(11)21-6-7-22-12(8-21)15(24)20(3)9-13(22)23/h4,12H,1,5-9H2,2-3H3,(H2,17,18,19)/t12-/m0/s1 |
| InChIKey | ZELMIRCPXKJPBE-LBPRGKRZSA-N |
| XLogP | -0.42 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|