C15H19F3N2O2 — CID 97201883
6-methyl-1-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-(trifluoromethyl)pyridin-2-one (PubChem CID 97201883) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 6-methyl-1-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 6-methyl-1-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 97201883 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 6-methyl-1-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-(trifluoromethyl)pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)F)cc(=O)n1[C@@H](C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-10-8-12(15(16,17)18)9-13(21)20(10)11(2)14(22)19-6-4-3-5-7-19/h8-9,11H,3-7H2,1-2H3/t11-/m0/s1 |
| InChIKey | JUGWZWCCSVQUKJ-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |