C12H14N6O2S — CID 97202109
(5R)-5-[[2-ethyl-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione (PubChem CID 97202109) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is (5R)-5-[[2-ethyl-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[2-ethyl-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97202109 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (5R)-5-[[2-ethyl-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CCn1nc(-c2csc(C)n2)nc1C[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C12H14N6O2S/c1-3-18-9(4-7-11(19)16-12(20)14-7)15-10(17-18)8-5-21-6(2)13-8/h5,7H,3-4H2,1-2H3,(H2,14,16,19,20)/t7-/m1/s1 |
| InChIKey | GTTJNAOCLSIAPT-SSDOTTSWSA-N |
| XLogP | 0.48 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|