About (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid
(2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid (PubChem CID 97202350) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid.
Molecular Properties
| Compound Name | (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid |
| PubChem CID | 97202350 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid |
| SMILES | CCc1cccc([C@H](C(=O)O)N(C)Cc2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-5-13-7-6-8-14(9-13)16(17(21)22)20(4)10-15-11(2)18-19-12(15)3/h6-9,16H,5,10H2,1-4H3,(H,18,19)(H,21,22)/t16-/m1/s1 |
| InChIKey | CNLSFXKIMXZOQH-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid?
The IUPAC name of (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid (CID 97202350) is (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid.
What is the SMILES notation for (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid?
The canonical SMILES for (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid is CCc1cccc([C@H](C(=O)O)N(C)Cc2c(C)n[nH]c2C)c1.
What is the InChIKey of (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid?
The InChIKey is CNLSFXKIMXZOQH-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-5-13-7-6-8-14(9-13)16(17(21)22)20(4)10-15-11(2)18-19-12(15)3/h6-9,16H,5,10H2,1-4H3,(H,18,19)(H,21,22)/t16-/m1/s1.
What are the key properties of (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid?
(2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid has a molecular weight of 301.39 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl-methylamino]-2-(3-ethylphenyl)acetic acid is sourced from PubChem (CID 97202350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).