C21H22N2O4 — CID 97202403
(4R)-1-(3-hydroxyphenyl)-4-[3-(2-methylphenoxy)azetidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 97202403) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (4R)-1-(3-hydroxyphenyl)-4-[3-(2-methylphenoxy)azetidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-(3-hydroxyphenyl)-4-[3-(2-methylphenoxy)azetidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 97202403 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (4R)-1-(3-hydroxyphenyl)-4-[3-(2-methylphenoxy)azetidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1ccccc1OC1CN(C(=O)[C@@H]2CC(=O)N(c3cccc(O)c3)C2)C1 |
| InChI | InChI=1S/C21H22N2O4/c1-14-5-2-3-8-19(14)27-18-12-22(13-18)21(26)15-9-20(25)23(11-15)16-6-4-7-17(24)10-16/h2-8,10,15,18,24H,9,11-13H2,1H3/t15-/m1/s1 |
| InChIKey | OJKOPOLVPTYRCI-OAHLLOKOSA-N |
| XLogP | 2.34 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |