C22H33N3O2 — CID 97204061
N-[1-(morpholin-4-ylmethyl)cyclopentyl]-4-[(3S)-piperidin-3-yl]benzamide (PubChem CID 97204061) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[1-(morpholin-4-ylmethyl)cyclopentyl]-4-[(3S)-piperidin-3-yl]benzamide.
| Compound Name | N-[1-(morpholin-4-ylmethyl)cyclopentyl]-4-[(3S)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97204061 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[1-(morpholin-4-ylmethyl)cyclopentyl]-4-[(3S)-piperidin-3-yl]benzamide |
| SMILES | O=C(NC1(CN2CCOCC2)CCCC1)c1ccc([C@@H]2CCCNC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c26-21(19-7-5-18(6-8-19)20-4-3-11-23-16-20)24-22(9-1-2-10-22)17-25-12-14-27-15-13-25/h5-8,20,23H,1-4,9-17H2,(H,24,26)/t20-/m1/s1 |
| InChIKey | GGOMHFZIGLODCZ-HXUWFJFHSA-N |
| XLogP | 2.53 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |