C20H29N3O2S — CID 97204101
(6S)-1,10-dimethyl-4-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 97204101) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is (6S)-1,10-dimethyl-4-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | (6S)-1,10-dimethyl-4-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 97204101 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (6S)-1,10-dimethyl-4-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CC[C@@]2(CCC1=O)CN(C(=O)c1cc3c(s1)CCCC3)CCN2C |
| InChI | InChI=1S/C20H29N3O2S/c1-21-10-9-20(8-7-18(21)24)14-23(12-11-22(20)2)19(25)17-13-15-5-3-4-6-16(15)26-17/h13H,3-12,14H2,1-2H3/t20-/m0/s1 |
| InChIKey | OIJZFYYTMQVFMN-FQEVSTJZSA-N |
| XLogP | 2.40 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |