C11H12N4O2 — CID 97204217
(2S)-2-cyano-N-pyridin-3-ylmorpholine-4-carboxamide (PubChem CID 97204217) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2S)-2-cyano-N-pyridin-3-ylmorpholine-4-carboxamide.
| Compound Name | (2S)-2-cyano-N-pyridin-3-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97204217 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (2S)-2-cyano-N-pyridin-3-ylmorpholine-4-carboxamide |
| SMILES | N#C[C@@H]1CN(C(=O)Nc2cccnc2)CCO1 |
| InChI | InChI=1S/C11H12N4O2/c12-6-10-8-15(4-5-17-10)11(16)14-9-2-1-3-13-7-9/h1-3,7,10H,4-5,8H2,(H,14,16)/t10-/m1/s1 |
| InChIKey | TZKVEFFAWHHALO-SNVBAGLBSA-N |
| XLogP | 0.84 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |