C21H22N6O — CID 97204837
(3S)-3-phenyl-8-(1-phenyltetrazol-5-yl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97204837) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is (3S)-3-phenyl-8-(1-phenyltetrazol-5-yl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3S)-3-phenyl-8-(1-phenyltetrazol-5-yl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97204837 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (3S)-3-phenyl-8-(1-phenyltetrazol-5-yl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCN(c3nnnn3-c3ccccc3)CC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22N6O/c28-19-18(16-7-3-1-4-8-16)15-21(22-19)11-13-26(14-12-21)20-23-24-25-27(20)17-9-5-2-6-10-17/h1-10,18H,11-15H2,(H,22,28)/t18-/m0/s1 |
| InChIKey | RUPKVRXJISGOID-SFHVURJKSA-N |
| XLogP | 2.31 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |